C19H15N5O3 — CID 23480045
4-(3,5-dimethylpyrazol-1-yl)-6-naphthalen-1-yloxy-5-nitropyrimidine (PubChem CID 23480045) has the molecular formula C19H15N5O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-6-naphthalen-1-yloxy-5-nitropyrimidine.
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-6-naphthalen-1-yloxy-5-nitropyrimidine |
|---|---|
| PubChem CID | 23480045 |
| Molecular Formula | C19H15N5O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-6-naphthalen-1-yloxy-5-nitropyrimidine |
| SMILES | Cc1cc(C)n(-c2ncnc(Oc3cccc4ccccc34)c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C19H15N5O3/c1-12-10-13(2)23(22-12)18-17(24(25)26)19(21-11-20-18)27-16-9-5-7-14-6-3-4-8-15(14)16/h3-11H,1-2H3 |
| InChIKey | DRINEUNKWGKMLZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|