C15H23N7O — CID 22543114
6-N-(3-imidazol-1-ylpropyl)-4-N-(oxolan-2-ylmethyl)pyrimidine-4,5,6-triamine (PubChem CID 22543114) has the molecular formula C15H23N7O and a molecular weight of 317.40 g/mol. Its IUPAC name is 6-N-(3-imidazol-1-ylpropyl)-4-N-(oxolan-2-ylmethyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(3-imidazol-1-ylpropyl)-4-N-(oxolan-2-ylmethyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22543114 |
| Molecular Formula | C15H23N7O |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 6-N-(3-imidazol-1-ylpropyl)-4-N-(oxolan-2-ylmethyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCCCn2ccnc2)ncnc1NCC1CCCO1 |
| InChI | InChI=1S/C15H23N7O/c16-13-14(18-4-2-6-22-7-5-17-11-22)20-10-21-15(13)19-9-12-3-1-8-23-12/h5,7,10-12H,1-4,6,8-9,16H2,(H2,18,19,20,21) |
| InChIKey | VSGHOAROBVOKLT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|