C15H16N6 — CID 22544226
4-N-(2-ethylphenyl)-6-imidazol-1-ylpyrimidine-4,5-diamine (PubChem CID 22544226) has the molecular formula C15H16N6 and a molecular weight of 280.34 g/mol. Its IUPAC name is 4-N-(2-ethylphenyl)-6-imidazol-1-ylpyrimidine-4,5-diamine.
| Compound Name | 4-N-(2-ethylphenyl)-6-imidazol-1-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22544226 |
| Molecular Formula | C15H16N6 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 4-N-(2-ethylphenyl)-6-imidazol-1-ylpyrimidine-4,5-diamine |
| SMILES | CCc1ccccc1Nc1ncnc(-n2ccnc2)c1N |
| InChI | InChI=1S/C15H16N6/c1-2-11-5-3-4-6-12(11)20-14-13(16)15(19-9-18-14)21-8-7-17-10-21/h3-10H,2,16H2,1H3,(H,18,19,20) |
| InChIKey | XSOIPZZKVCFXCA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |