C18H19N3O3S — CID 22548598
N-[[4-(dimethylamino)phenyl]methyl]-2-oxo-1H-quinoline-6-sulfonamide (PubChem CID 22548598) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-oxo-1H-quinoline-6-sulfonamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-oxo-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 22548598 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-oxo-1H-quinoline-6-sulfonamide |
| SMILES | CN(C)c1ccc(CNS(=O)(=O)c2ccc3[nH]c(=O)ccc3c2)cc1 |
| InChI | InChI=1S/C18H19N3O3S/c1-21(2)15-6-3-13(4-7-15)12-19-25(23,24)16-8-9-17-14(11-16)5-10-18(22)20-17/h3-11,19H,12H2,1-2H3,(H,20,22) |
| InChIKey | CSNKQRABNUFNOU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|