C16H10ClFN4O2S — CID 22552458
N-(4-chloro-2-fluorophenyl)-2-(5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide (PubChem CID 22552458) has the molecular formula C16H10ClFN4O2S and a molecular weight of 376.80 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-(5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-(5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 22552458 |
| Molecular Formula | C16H10ClFN4O2S |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-(5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nncn2c1cc1occc12)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C16H10ClFN4O2S/c17-9-1-2-11(10(18)5-9)20-15(23)7-25-16-13-6-14-12(3-4-24-14)22(13)8-19-21-16/h1-6,8H,7H2,(H,20,23) |
| InChIKey | KJOWJTYMTYMJOD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |