C17H13N5OS — CID 22552546
9-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-12-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 22552546) has the molecular formula C17H13N5OS and a molecular weight of 335.39 g/mol. Its IUPAC name is 9-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-12-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 9-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-12-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 22552546 |
| Molecular Formula | C17H13N5OS |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 9-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)-12-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Cc1nnc(SCc2cn3ccccc3n2)c2cc3occc3n12 |
| InChI | InChI=1S/C17H13N5OS/c1-11-19-20-17(14-8-15-13(22(11)14)5-7-23-15)24-10-12-9-21-6-3-2-4-16(21)18-12/h2-9H,10H2,1H3 |
| InChIKey | YHKOYMSEHAUQRK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |