C18H16N4O3S — CID 22552549
N-(4-methoxyphenyl)-2-[(12-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]acetamide (PubChem CID 22552549) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[(12-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[(12-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 22552549 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[(12-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nnc(C)n3c2cc2occc23)cc1 |
| InChI | InChI=1S/C18H16N4O3S/c1-11-20-21-18(15-9-16-14(22(11)15)7-8-25-16)26-10-17(23)19-12-3-5-13(24-2)6-4-12/h3-9H,10H2,1-2H3,(H,19,23) |
| InChIKey | LAHNJWJHNOFSLM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |