C18H22N4O2S — CID 46273849
N-cyclohexyl-N-methyl-2-[(12-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]acetamide (PubChem CID 46273849) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-2-[(12-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]acetamide.
| Compound Name | N-cyclohexyl-N-methyl-2-[(12-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 46273849 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-cyclohexyl-N-methyl-2-[(12-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]acetamide |
| SMILES | Cc1nnc(SCC(=O)N(C)C2CCCCC2)c2cc3occc3n12 |
| InChI | InChI=1S/C18H22N4O2S/c1-12-19-20-18(15-10-16-14(22(12)15)8-9-24-16)25-11-17(23)21(2)13-6-4-3-5-7-13/h8-10,13H,3-7,11H2,1-2H3 |
| InChIKey | SUTCXQIIFGCZIV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |