C19H18N4O2S — CID 22552592
2-[(4,12-dimethyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]-N-methyl-N-phenylacetamide (PubChem CID 22552592) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 2-[(4,12-dimethyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]-N-methyl-N-phenylacetamide.
| Compound Name | 2-[(4,12-dimethyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 22552592 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[(4,12-dimethyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]-N-methyl-N-phenylacetamide |
| SMILES | Cc1cc2c(cc3c(SCC(=O)N(C)c4ccccc4)nnc(C)n32)o1 |
| InChI | InChI=1S/C19H18N4O2S/c1-12-9-15-17(25-12)10-16-19(21-20-13(2)23(15)16)26-11-18(24)22(3)14-7-5-4-6-8-14/h4-10H,11H2,1-3H3 |
| InChIKey | FTCRFDDXJZWURW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 63.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |