C18H27N3O4S — CID 22552749
N-(2,4-dimethylphenyl)-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide (PubChem CID 22552749) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 22552749 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCCN(S(=O)(=O)N3CCOCC3)C2)c(C)c1 |
| InChI | InChI=1S/C18H27N3O4S/c1-14-5-6-17(15(2)12-14)19-18(22)16-4-3-7-21(13-16)26(23,24)20-8-10-25-11-9-20/h5-6,12,16H,3-4,7-11,13H2,1-2H3,(H,19,22) |
| InChIKey | FMDRILRDMAVVSW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |