C19H30N4O5S2 — CID 22552986
1-piperidin-1-ylsulfonyl-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-3-carboxamide (PubChem CID 22552986) has the molecular formula C19H30N4O5S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 1-piperidin-1-ylsulfonyl-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-piperidin-1-ylsulfonyl-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 22552986 |
| Molecular Formula | C19H30N4O5S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 1-piperidin-1-ylsulfonyl-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)C2CCCN(S(=O)(=O)N3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C19H30N4O5S2/c20-29(25,26)18-8-6-16(7-9-18)10-11-21-19(24)17-5-4-14-23(15-17)30(27,28)22-12-2-1-3-13-22/h6-9,17H,1-5,10-15H2,(H,21,24)(H2,20,25,26) |
| InChIKey | XIFNDWVGOODMLK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |