C23H34N4O3S — CID 22553850
6-methyl-N-[2-[3-(4-propylpiperazin-1-yl)propylcarbamoyl]phenyl]-2,3-dihydro-1,4-oxathiine-5-carboxamide (PubChem CID 22553850) has the molecular formula C23H34N4O3S and a molecular weight of 446.62 g/mol. Its IUPAC name is 6-methyl-N-[2-[3-(4-propylpiperazin-1-yl)propylcarbamoyl]phenyl]-2,3-dihydro-1,4-oxathiine-5-carboxamide.
| Compound Name | 6-methyl-N-[2-[3-(4-propylpiperazin-1-yl)propylcarbamoyl]phenyl]-2,3-dihydro-1,4-oxathiine-5-carboxamide |
|---|---|
| PubChem CID | 22553850 |
| Molecular Formula | C23H34N4O3S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 6-methyl-N-[2-[3-(4-propylpiperazin-1-yl)propylcarbamoyl]phenyl]-2,3-dihydro-1,4-oxathiine-5-carboxamide |
| SMILES | CCCN1CCN(CCCNC(=O)c2ccccc2NC(=O)C2=C(C)OCCS2)CC1 |
| InChI | InChI=1S/C23H34N4O3S/c1-3-10-26-12-14-27(15-13-26)11-6-9-24-22(28)19-7-4-5-8-20(19)25-23(29)21-18(2)30-16-17-31-21/h4-5,7-8H,3,6,9-17H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | HUGMLOZKNZFGBO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|