C21H29N3O3S — CID 22554073
6-methyl-N-[4-(3-piperidin-1-ylpropylcarbamoyl)phenyl]-2,3-dihydro-1,4-oxathiine-5-carboxamide (PubChem CID 22554073) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 6-methyl-N-[4-(3-piperidin-1-ylpropylcarbamoyl)phenyl]-2,3-dihydro-1,4-oxathiine-5-carboxamide.
| Compound Name | 6-methyl-N-[4-(3-piperidin-1-ylpropylcarbamoyl)phenyl]-2,3-dihydro-1,4-oxathiine-5-carboxamide |
|---|---|
| PubChem CID | 22554073 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 6-methyl-N-[4-(3-piperidin-1-ylpropylcarbamoyl)phenyl]-2,3-dihydro-1,4-oxathiine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C(=O)NCCCN3CCCCC3)cc2)SCCO1 |
| InChI | InChI=1S/C21H29N3O3S/c1-16-19(28-15-14-27-16)21(26)23-18-8-6-17(7-9-18)20(25)22-10-5-13-24-11-3-2-4-12-24/h6-9H,2-5,10-15H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | CFVWKQJFQWBGLT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|