C17H24SSi — CID 22555346
(2-butylsulfanylphenyl)-cyclopenta-1,4-dien-1-yl-dimethylsilane (PubChem CID 22555346) has the molecular formula C17H24SSi and a molecular weight of 288.53 g/mol. Its IUPAC name is (2-butylsulfanylphenyl)-cyclopenta-1,4-dien-1-yl-dimethylsilane.
| Compound Name | (2-butylsulfanylphenyl)-cyclopenta-1,4-dien-1-yl-dimethylsilane |
|---|---|
| PubChem CID | 22555346 |
| Molecular Formula | C17H24SSi |
| Molecular Weight | 288.53 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (2-butylsulfanylphenyl)-cyclopenta-1,4-dien-1-yl-dimethylsilane |
| SMILES | CCCCSc1ccccc1[Si](C)(C)C1=CCC=C1 |
| InChI | InChI=1S/C17H24SSi/c1-4-5-14-18-16-12-8-9-13-17(16)19(2,3)15-10-6-7-11-15/h6,8-13H,4-5,7,14H2,1-3H3 |
| InChIKey | USCHGXJNMLGKLE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|