C14H15Cl2O2Ti — CID 22555719
1-cyclopenta-1,4-dien-1-yloxy-2-propoxybenzene;titanium(3+);dichloride (PubChem CID 22555719) has the molecular formula C14H15Cl2O2Ti and a molecular weight of 334.04 g/mol. Its IUPAC name is 1-cyclopenta-1,4-dien-1-yloxy-2-propoxybenzene;titanium(3+);dichloride.
| Compound Name | 1-cyclopenta-1,4-dien-1-yloxy-2-propoxybenzene;titanium(3+);dichloride |
|---|---|
| PubChem CID | 22555719 |
| Molecular Formula | C14H15Cl2O2Ti |
| Molecular Weight | 334.04 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 1-cyclopenta-1,4-dien-1-yloxy-2-propoxybenzene;titanium(3+);dichloride |
| SMILES | CCCOc1ccccc1OC1=[C-]CC=C1.[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C14H15O2.2ClH.Ti/c1-2-11-15-13-9-5-6-10-14(13)16-12-7-3-4-8-12;;;/h3,5-7,9-10H,2,4,11H2,1H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | YNMILIOBFZYKAO-UHFFFAOYSA-L |
| XLogP | -2.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.04 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|