About N,N-dimethyldecan-1-amine oxide;dihydrate
N,N-dimethyldecan-1-amine oxide;dihydrate (PubChem CID 22556484) has the molecular formula C12H31NO3
and a molecular weight of 237.38 g/mol. Its IUPAC name is N,N-dimethyldecan-1-amine oxide;dihydrate.
Molecular Properties
| Compound Name | N,N-dimethyldecan-1-amine oxide;dihydrate |
| PubChem CID | 22556484 |
| Molecular Formula | C12H31NO3 |
| Molecular Weight | 237.38 g/mol |
| Exact Mass | 237.23 |
| IUPAC Name | N,N-dimethyldecan-1-amine oxide;dihydrate |
| SMILES | CCCCCCCCCC[N+](C)(C)[O-].O.O |
| InChI | InChI=1S/C12H27NO.2H2O/c1-4-5-6-7-8-9-10-11-12-13(2,3)14;;/h4-12H2,1-3H3;2*1H2 |
| InChIKey | MLHVGGKBMSJJAI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 86.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyldecan-1-amine oxide;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyldecan-1-amine oxide;dihydrate?
The IUPAC name of N,N-dimethyldecan-1-amine oxide;dihydrate (CID 22556484) is N,N-dimethyldecan-1-amine oxide;dihydrate.
What is the SMILES notation for N,N-dimethyldecan-1-amine oxide;dihydrate?
The canonical SMILES for N,N-dimethyldecan-1-amine oxide;dihydrate is CCCCCCCCCC[N+](C)(C)[O-].O.O.
What is the InChIKey of N,N-dimethyldecan-1-amine oxide;dihydrate?
The InChIKey is MLHVGGKBMSJJAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO.2H2O/c1-4-5-6-7-8-9-10-11-12-13(2,3)14;;/h4-12H2,1-3H3;2*1H2.
What are the key properties of N,N-dimethyldecan-1-amine oxide;dihydrate?
N,N-dimethyldecan-1-amine oxide;dihydrate has a molecular weight of 237.38 g/mol, XLogP of 2.05, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyldecan-1-amine oxide;dihydrate is sourced from PubChem (CID 22556484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).