C28H24F3NO3 — CID 22558897
methyl 3-[3-amino-5-naphthalen-2-yl-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoate (PubChem CID 22558897) has the molecular formula C28H24F3NO3 and a molecular weight of 479.50 g/mol. Its IUPAC name is methyl 3-[3-amino-5-naphthalen-2-yl-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoate.
| Compound Name | methyl 3-[3-amino-5-naphthalen-2-yl-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 22558897 |
| Molecular Formula | C28H24F3NO3 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | methyl 3-[3-amino-5-naphthalen-2-yl-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1cc(N)c(OCc2ccc(C(F)(F)F)cc2)c(-c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C28H24F3NO3/c1-34-26(33)13-8-19-14-24(22-10-9-20-4-2-3-5-21(20)16-22)27(25(32)15-19)35-17-18-6-11-23(12-7-18)28(29,30)31/h2-7,9-12,14-16H,8,13,17,32H2,1H3 |
| InChIKey | QZZQTXZNHLUYAC-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|