C27H22F3NO3 — CID 22558991
3-[3-amino-5-naphthalen-2-yl-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoic acid (PubChem CID 22558991) has the molecular formula C27H22F3NO3 and a molecular weight of 465.47 g/mol. Its IUPAC name is 3-[3-amino-5-naphthalen-2-yl-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[3-amino-5-naphthalen-2-yl-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22558991 |
| Molecular Formula | C27H22F3NO3 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 3-[3-amino-5-naphthalen-2-yl-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoic acid |
| SMILES | Nc1cc(CCC(=O)O)cc(-c2ccc3ccccc3c2)c1OCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H22F3NO3/c28-27(29,30)22-10-5-17(6-11-22)16-34-26-23(13-18(14-24(26)31)7-12-25(32)33)21-9-8-19-3-1-2-4-20(19)15-21/h1-6,8-11,13-15H,7,12,16,31H2,(H,32,33) |
| InChIKey | LMBPAURIUZPCLW-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|