About 4-bromo-1-methylindazole
4-bromo-1-methylindazole (PubChem CID 22558986) has the molecular formula C8H7BrN2
and a molecular weight of 211.06 g/mol. Its IUPAC name is 4-bromo-1-methylindazole.
Molecular Properties
| Compound Name | 4-bromo-1-methylindazole |
| PubChem CID | 22558986 |
| Molecular Formula | C8H7BrN2 |
| Molecular Weight | 211.06 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | 4-bromo-1-methylindazole |
| SMILES | Cn1ncc2c(Br)cccc21 |
| InChI | InChI=1S/C8H7BrN2/c1-11-8-4-2-3-7(9)6(8)5-10-11/h2-5H,1H3 |
| InChIKey | AQUSISHVASVOBL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.06 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-1-methylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-methylindazole?
The IUPAC name of 4-bromo-1-methylindazole (CID 22558986) is 4-bromo-1-methylindazole.
What is the SMILES notation for 4-bromo-1-methylindazole?
The canonical SMILES for 4-bromo-1-methylindazole is Cn1ncc2c(Br)cccc21.
What is the InChIKey of 4-bromo-1-methylindazole?
The InChIKey is AQUSISHVASVOBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2/c1-11-8-4-2-3-7(9)6(8)5-10-11/h2-5H,1H3.
What are the key properties of 4-bromo-1-methylindazole?
4-bromo-1-methylindazole has a molecular weight of 211.06 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-methylindazole is sourced from PubChem (CID 22558986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).