C17H20N2O — CID 2256128
3-[2-(cyclohexen-1-yl)ethyliminomethyl]-1H-indol-2-ol (PubChem CID 2256128) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyliminomethyl]-1H-indol-2-ol.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyliminomethyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 2256128 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyliminomethyl]-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccccc2c1/C=N/CCC1=CCCCC1 |
| InChI | InChI=1S/C17H20N2O/c20-17-15(14-8-4-5-9-16(14)19-17)12-18-11-10-13-6-2-1-3-7-13/h4-6,8-9,12,19-20H,1-3,7,10-11H2/b18-12+ |
| InChIKey | BUYSEYSNXWESEM-LDADJPATSA-N |
| XLogP | 4.18 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|