C16H12Cl2N2O — CID 2256130
3-[(2,4-dichlorophenyl)methyliminomethyl]-1H-indol-2-ol (PubChem CID 2256130) has the molecular formula C16H12Cl2N2O and a molecular weight of 319.19 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyliminomethyl]-1H-indol-2-ol.
| Compound Name | 3-[(2,4-dichlorophenyl)methyliminomethyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 2256130 |
| Molecular Formula | C16H12Cl2N2O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyliminomethyl]-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccccc2c1/C=N/Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl2N2O/c17-11-6-5-10(14(18)7-11)8-19-9-13-12-3-1-2-4-15(12)20-16(13)21/h1-7,9,20-21H,8H2/b19-9+ |
| InChIKey | JTWBBLIJKOOWCZ-DJKKODMXSA-N |
| XLogP | 4.80 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|