C28H40N4O4S2 — CID 22562941
S-ethyl 4-[8-[5,5-dimethyl-4-oxo-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylideneimidazolidin-1-yl]octyl]piperazine-1-carbothioate (PubChem CID 22562941) has the molecular formula C28H40N4O4S2 and a molecular weight of 560.79 g/mol. Its IUPAC name is S-ethyl 4-[8-[5,5-dimethyl-4-oxo-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylideneimidazolidin-1-yl]octyl]piperazine-1-carbothioate.
| Compound Name | S-ethyl 4-[8-[5,5-dimethyl-4-oxo-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylideneimidazolidin-1-yl]octyl]piperazine-1-carbothioate |
|---|---|
| PubChem CID | 22562941 |
| Molecular Formula | C28H40N4O4S2 |
| Molecular Weight | 560.79 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | S-ethyl 4-[8-[5,5-dimethyl-4-oxo-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylideneimidazolidin-1-yl]octyl]piperazine-1-carbothioate |
| SMILES | CCSC(=O)N1CCN(CCCCCCCCN2C(=S)N(c3ccc4c(c3)COC4=O)C(=O)C2(C)C)CC1 |
| InChI | InChI=1S/C28H40N4O4S2/c1-4-38-27(35)30-17-15-29(16-18-30)13-9-7-5-6-8-10-14-31-26(37)32(25(34)28(31,2)3)22-11-12-23-21(19-22)20-36-24(23)33/h11-12,19H,4-10,13-18,20H2,1-3H3 |
| InChIKey | BBZXMQHCPYRRNI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.79 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|