C18H26ClNO6S — CID 22565205
ethyl 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-(2,2-diethoxyethyl)amino]acetate (PubChem CID 22565205) has the molecular formula C18H26ClNO6S and a molecular weight of 419.93 g/mol. Its IUPAC name is ethyl 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-(2,2-diethoxyethyl)amino]acetate.
| Compound Name | ethyl 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-(2,2-diethoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 22565205 |
| Molecular Formula | C18H26ClNO6S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | ethyl 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-(2,2-diethoxyethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CC(OCC)OCC)S(=O)(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H26ClNO6S/c1-4-24-17(21)13-20(14-18(25-5-2)26-6-3)27(22,23)12-11-15-7-9-16(19)10-8-15/h7-12,18H,4-6,13-14H2,1-3H3/b12-11+ |
| InChIKey | AVMLMRMVDNFOOR-VAWYXSNFSA-N |
| XLogP | 2.90 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|