C16H12F2N2O2 — CID 22568421
3-[(5,6-difluoro-1H-indol-2-yl)methoxy]benzamide (PubChem CID 22568421) has the molecular formula C16H12F2N2O2 and a molecular weight of 302.28 g/mol. Its IUPAC name is 3-[(5,6-difluoro-1H-indol-2-yl)methoxy]benzamide.
| Compound Name | 3-[(5,6-difluoro-1H-indol-2-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 22568421 |
| Molecular Formula | C16H12F2N2O2 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3-[(5,6-difluoro-1H-indol-2-yl)methoxy]benzamide |
| SMILES | NC(=O)c1cccc(OCc2cc3cc(F)c(F)cc3[nH]2)c1 |
| InChI | InChI=1S/C16H12F2N2O2/c17-13-6-10-4-11(20-15(10)7-14(13)18)8-22-12-3-1-2-9(5-12)16(19)21/h1-7,20H,8H2,(H2,19,21) |
| InChIKey | UHGBXIVBJUJMBB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |