C23H18F2N2O3 — CID 22568441
4-[[5-(5,6-difluoro-1H-indol-2-yl)-2-methoxyanilino]methyl]benzoic acid (PubChem CID 22568441) has the molecular formula C23H18F2N2O3 and a molecular weight of 408.40 g/mol. Its IUPAC name is 4-[[5-(5,6-difluoro-1H-indol-2-yl)-2-methoxyanilino]methyl]benzoic acid.
| Compound Name | 4-[[5-(5,6-difluoro-1H-indol-2-yl)-2-methoxyanilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 22568441 |
| Molecular Formula | C23H18F2N2O3 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4-[[5-(5,6-difluoro-1H-indol-2-yl)-2-methoxyanilino]methyl]benzoic acid |
| SMILES | COc1ccc(-c2cc3cc(F)c(F)cc3[nH]2)cc1NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H18F2N2O3/c1-30-22-7-6-15(19-10-16-8-17(24)18(25)11-20(16)27-19)9-21(22)26-12-13-2-4-14(5-3-13)23(28)29/h2-11,26-27H,12H2,1H3,(H,28,29) |
| InChIKey | CCEQENPPMIKCOK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |