C22H25F2N3O5S — CID 91235800
6-[[5-(5,6-difluoro-1H-indol-2-yl)-2-methoxyphenyl]sulfamoyl]hexyl carbamate (PubChem CID 91235800) has the molecular formula C22H25F2N3O5S and a molecular weight of 481.52 g/mol. Its IUPAC name is 6-[[5-(5,6-difluoro-1H-indol-2-yl)-2-methoxyphenyl]sulfamoyl]hexyl carbamate.
| Compound Name | 6-[[5-(5,6-difluoro-1H-indol-2-yl)-2-methoxyphenyl]sulfamoyl]hexyl carbamate |
|---|---|
| PubChem CID | 91235800 |
| Molecular Formula | C22H25F2N3O5S |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 6-[[5-(5,6-difluoro-1H-indol-2-yl)-2-methoxyphenyl]sulfamoyl]hexyl carbamate |
| SMILES | COc1ccc(-c2cc3cc(F)c(F)cc3[nH]2)cc1NS(=O)(=O)CCCCCCOC(N)=O |
| InChI | InChI=1S/C22H25F2N3O5S/c1-31-21-7-6-14(18-12-15-10-16(23)17(24)13-19(15)26-18)11-20(21)27-33(29,30)9-5-3-2-4-8-32-22(25)28/h6-7,10-13,26-27H,2-5,8-9H2,1H3,(H2,25,28) |
| InChIKey | YVLAIOIOGPDGPM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|