C10H13ClO5S2 — CID 22568718
6-chloro-3-hydroxy-6-thiophen-2-ylsulfonylhexanoic acid (PubChem CID 22568718) has the molecular formula C10H13ClO5S2 and a molecular weight of 312.80 g/mol. Its IUPAC name is 6-chloro-3-hydroxy-6-thiophen-2-ylsulfonylhexanoic acid.
| Compound Name | 6-chloro-3-hydroxy-6-thiophen-2-ylsulfonylhexanoic acid |
|---|---|
| PubChem CID | 22568718 |
| Molecular Formula | C10H13ClO5S2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 6-chloro-3-hydroxy-6-thiophen-2-ylsulfonylhexanoic acid |
| SMILES | O=C(O)CC(O)CCC(Cl)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C10H13ClO5S2/c11-8(4-3-7(12)6-9(13)14)18(15,16)10-2-1-5-17-10/h1-2,5,7-8,12H,3-4,6H2,(H,13,14) |
| InChIKey | CJLSCPSFBSZDRR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|