C28H28FN3O6S — CID 22570066
[4-[[2-[4-(4-fluoro-2-methylsulfonylphenyl)piperazin-1-yl]-2-oxoethyl]-phenylcarbamoyl]phenyl] acetate (PubChem CID 22570066) has the molecular formula C28H28FN3O6S and a molecular weight of 553.61 g/mol. Its IUPAC name is [4-[[2-[4-(4-fluoro-2-methylsulfonylphenyl)piperazin-1-yl]-2-oxoethyl]-phenylcarbamoyl]phenyl] acetate.
| Compound Name | [4-[[2-[4-(4-fluoro-2-methylsulfonylphenyl)piperazin-1-yl]-2-oxoethyl]-phenylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 22570066 |
| Molecular Formula | C28H28FN3O6S |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | [4-[[2-[4-(4-fluoro-2-methylsulfonylphenyl)piperazin-1-yl]-2-oxoethyl]-phenylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)N(CC(=O)N2CCN(c3ccc(F)cc3S(C)(=O)=O)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28FN3O6S/c1-20(33)38-24-11-8-21(9-12-24)28(35)32(23-6-4-3-5-7-23)19-27(34)31-16-14-30(15-17-31)25-13-10-22(29)18-26(25)39(2,36)37/h3-13,18H,14-17,19H2,1-2H3 |
| InChIKey | GAXAWQXIOSCHDG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|