C27H29FN4O4S — CID 22570067
3-amino-N-[2-[4-(4-fluoro-2-methylsulfonylphenyl)piperazin-1-yl]-2-oxoethyl]-4-methyl-N-phenylbenzamide (PubChem CID 22570067) has the molecular formula C27H29FN4O4S and a molecular weight of 524.62 g/mol. Its IUPAC name is 3-amino-N-[2-[4-(4-fluoro-2-methylsulfonylphenyl)piperazin-1-yl]-2-oxoethyl]-4-methyl-N-phenylbenzamide.
| Compound Name | 3-amino-N-[2-[4-(4-fluoro-2-methylsulfonylphenyl)piperazin-1-yl]-2-oxoethyl]-4-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 22570067 |
| Molecular Formula | C27H29FN4O4S |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 3-amino-N-[2-[4-(4-fluoro-2-methylsulfonylphenyl)piperazin-1-yl]-2-oxoethyl]-4-methyl-N-phenylbenzamide |
| SMILES | Cc1ccc(C(=O)N(CC(=O)N2CCN(c3ccc(F)cc3S(C)(=O)=O)CC2)c2ccccc2)cc1N |
| InChI | InChI=1S/C27H29FN4O4S/c1-19-8-9-20(16-23(19)29)27(34)32(22-6-4-3-5-7-22)18-26(33)31-14-12-30(13-15-31)24-11-10-21(28)17-25(24)37(2,35)36/h3-11,16-17H,12-15,18,29H2,1-2H3 |
| InChIKey | IHNCVLGHLATEHR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|