C19H20N2O4 — CID 22570284
3-[5-(2-aminooxyethoxy)indol-1-yl]-3-phenylpropanoic acid (PubChem CID 22570284) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-[5-(2-aminooxyethoxy)indol-1-yl]-3-phenylpropanoic acid.
| Compound Name | 3-[5-(2-aminooxyethoxy)indol-1-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22570284 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-[5-(2-aminooxyethoxy)indol-1-yl]-3-phenylpropanoic acid |
| SMILES | NOCCOc1ccc2c(ccn2C(CC(=O)O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H20N2O4/c20-25-11-10-24-16-6-7-17-15(12-16)8-9-21(17)18(13-19(22)23)14-4-2-1-3-5-14/h1-9,12,18H,10-11,13,20H2,(H,22,23) |
| InChIKey | NQQVZGRJECGPLU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|