C15H14N6O4 — CID 22570468
ethyl N-[6-(4-nitroanilino)-1H-imidazo[4,5-b]pyridin-2-yl]carbamate (PubChem CID 22570468) has the molecular formula C15H14N6O4 and a molecular weight of 342.32 g/mol. Its IUPAC name is ethyl N-[6-(4-nitroanilino)-1H-imidazo[4,5-b]pyridin-2-yl]carbamate.
| Compound Name | ethyl N-[6-(4-nitroanilino)-1H-imidazo[4,5-b]pyridin-2-yl]carbamate |
|---|---|
| PubChem CID | 22570468 |
| Molecular Formula | C15H14N6O4 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | ethyl N-[6-(4-nitroanilino)-1H-imidazo[4,5-b]pyridin-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nc2ncc(Nc3ccc([N+](=O)[O-])cc3)cc2[nH]1 |
| InChI | InChI=1S/C15H14N6O4/c1-2-25-15(22)20-14-18-12-7-10(8-16-13(12)19-14)17-9-3-5-11(6-4-9)21(23)24/h3-8,17H,2H2,1H3,(H2,16,18,19,20,22) |
| InChIKey | IQGOJCUGYJOJLD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|