C16H16N4O3 — CID 22570394
ethyl N-[6-(4-methylphenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]carbamate (PubChem CID 22570394) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is ethyl N-[6-(4-methylphenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]carbamate.
| Compound Name | ethyl N-[6-(4-methylphenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]carbamate |
|---|---|
| PubChem CID | 22570394 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | ethyl N-[6-(4-methylphenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nc2ncc(Oc3ccc(C)cc3)cc2[nH]1 |
| InChI | InChI=1S/C16H16N4O3/c1-3-22-16(21)20-15-18-13-8-12(9-17-14(13)19-15)23-11-6-4-10(2)5-7-11/h4-9H,3H2,1-2H3,(H2,17,18,19,20,21) |
| InChIKey | DMPFGDHRUDFPAB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |