C16H17N3OS2 — CID 22573745
N-(2-azabicyclo[2.2.1]heptan-5-yl)-4-(1,3-thiazol-2-ylsulfanyl)benzamide (PubChem CID 22573745) has the molecular formula C16H17N3OS2 and a molecular weight of 331.47 g/mol. Its IUPAC name is N-(2-azabicyclo[2.2.1]heptan-5-yl)-4-(1,3-thiazol-2-ylsulfanyl)benzamide.
| Compound Name | N-(2-azabicyclo[2.2.1]heptan-5-yl)-4-(1,3-thiazol-2-ylsulfanyl)benzamide |
|---|---|
| PubChem CID | 22573745 |
| Molecular Formula | C16H17N3OS2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-(2-azabicyclo[2.2.1]heptan-5-yl)-4-(1,3-thiazol-2-ylsulfanyl)benzamide |
| SMILES | O=C(NC1CC2CC1CN2)c1ccc(Sc2nccs2)cc1 |
| InChI | InChI=1S/C16H17N3OS2/c20-15(19-14-8-12-7-11(14)9-18-12)10-1-3-13(4-2-10)22-16-17-5-6-21-16/h1-6,11-12,14,18H,7-9H2,(H,19,20) |
| InChIKey | ASLPIKUVQYPGTN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|