C24H20N4O2 — CID 22573945
N-[2-(1H-indol-3-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]furan-2-carboxamide (PubChem CID 22573945) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]furan-2-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 22573945 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]furan-2-carboxamide |
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)c1ncc(-c2ccccc2)[nH]1)c1ccco1 |
| InChI | InChI=1S/C24H20N4O2/c29-24(22-11-6-12-30-22)28-20(13-17-14-25-19-10-5-4-9-18(17)19)23-26-15-21(27-23)16-7-2-1-3-8-16/h1-12,14-15,20,25H,13H2,(H,26,27)(H,28,29) |
| InChIKey | VBYRSOFYXZJDHQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |