C43H44BN8O2 — CID 161183001
CID 161183001 (PubChem CID 161183001) has the molecular formula C43H44BN8O2 and a molecular weight of 715.69 g/mol.
| Compound Name | CID 161183001 |
|---|---|
| PubChem CID | 161183001 |
| Molecular Formula | C43H44BN8O2 |
| Molecular Weight | 715.69 g/mol |
| Exact Mass | 715.37 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1c[nH]c2ccccc12)c1ncc(-c2ccccc2)[nH]1.N[C@H](Cc1c[nH]c2ccccc12)c1ncc(-c2ccccc2)[nH]1.[B] |
| InChI | InChI=1S/C24H26N4O2.C19H18N4.B/c1-24(2,3)30-23(29)28-20(13-17-14-25-19-12-8-7-11-18(17)19)22-26-15-21(27-22)16-9-5-4-6-10-16;20-16(10-14-11-21-17-9-5-4-8-15(14)17)19-22-12-18(23-19)13-6-2-1-3-7-13;/h4-12,14-15,20,25H,13H2,1-3H3,(H,26,27)(H,28,29);1-9,11-12,16,21H,10,20H2,(H,22,23);/t20-;16-;/m11./s1 |
| InChIKey | RAOZDCNJNNEOIT-QMCPHDCYSA-N |
| XLogP | 8.79 |
| TPSA | 153.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.69 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|