C27H35IN6O2S — CID 91589642
tert-butyl N-[1-[5-(4-aminophenyl)-1H-imidazol-2-yl]-2-(1H-indol-3-yl)ethyl]carbamate;methyl ethanimidothioate;hydroiodide (PubChem CID 91589642) has the molecular formula C27H35IN6O2S and a molecular weight of 634.59 g/mol. Its IUPAC name is tert-butyl N-[1-[5-(4-aminophenyl)-1H-imidazol-2-yl]-2-(1H-indol-3-yl)ethyl]carbamate;methyl ethanimidothioate;hydroiodide.
| Compound Name | tert-butyl N-[1-[5-(4-aminophenyl)-1H-imidazol-2-yl]-2-(1H-indol-3-yl)ethyl]carbamate;methyl ethanimidothioate;hydroiodide |
|---|---|
| PubChem CID | 91589642 |
| Molecular Formula | C27H35IN6O2S |
| Molecular Weight | 634.59 g/mol |
| Exact Mass | 634.16 |
| IUPAC Name | tert-butyl N-[1-[5-(4-aminophenyl)-1H-imidazol-2-yl]-2-(1H-indol-3-yl)ethyl]carbamate;methyl ethanimidothioate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)NC(Cc1c[nH]c2ccccc12)c1ncc(-c2ccc(N)cc2)[nH]1.I.[H]/N=C(\C)SC |
| InChI | InChI=1S/C24H27N5O2.C3H7NS.HI/c1-24(2,3)31-23(30)29-20(12-16-13-26-19-7-5-4-6-18(16)19)22-27-14-21(28-22)15-8-10-17(25)11-9-15;1-3(4)5-2;/h4-11,13-14,20,26H,12,25H2,1-3H3,(H,27,28)(H,29,30);4H,1-2H3;1H/b;4-3+; |
| InChIKey | QANRKTKQZMQSKH-ITDJAWRYSA-N |
| XLogP | 6.91 |
| TPSA | 132.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|