C26H27N3O2 — CID 59838366
tert-butyl N-[(1R)-2-naphthalen-2-yl-1-(5-phenyl-1H-imidazol-2-yl)ethyl]carbamate (PubChem CID 59838366) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-naphthalen-2-yl-1-(5-phenyl-1H-imidazol-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-naphthalen-2-yl-1-(5-phenyl-1H-imidazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 59838366 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | tert-butyl N-[(1R)-2-naphthalen-2-yl-1-(5-phenyl-1H-imidazol-2-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccc2ccccc2c1)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C26H27N3O2/c1-26(2,3)31-25(30)29-22(16-18-13-14-19-9-7-8-12-21(19)15-18)24-27-17-23(28-24)20-10-5-4-6-11-20/h4-15,17,22H,16H2,1-3H3,(H,27,28)(H,29,30)/t22-/m1/s1 |
| InChIKey | XMIBCIJQOWBRLU-JOCHJYFZSA-N |
| XLogP | 6.04 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |