C25H27N3O2 — CID 58325937
tert-butyl N-[(1R)-2-(3H-inden-1-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]carbamate (PubChem CID 58325937) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-(3H-inden-1-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-(3H-inden-1-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 58325937 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | tert-butyl N-[(1R)-2-(3H-inden-1-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CCc2ccccc21)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C25H27N3O2/c1-25(2,3)30-24(29)28-21(15-19-14-13-17-9-7-8-12-20(17)19)23-26-16-22(27-23)18-10-5-4-6-11-18/h4-12,14,16,21H,13,15H2,1-3H3,(H,26,27)(H,28,29)/t21-/m1/s1 |
| InChIKey | XUNICNODCUXIFS-OAQYLSRUSA-N |
| XLogP | 5.67 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |