C19H19ClN2OS — CID 22576484
[3-[(4-chlorophenyl)methyl]-2-[(3-methylphenyl)methylsulfanyl]imidazol-4-yl]methanol (PubChem CID 22576484) has the molecular formula C19H19ClN2OS and a molecular weight of 358.89 g/mol. Its IUPAC name is [3-[(4-chlorophenyl)methyl]-2-[(3-methylphenyl)methylsulfanyl]imidazol-4-yl]methanol.
| Compound Name | [3-[(4-chlorophenyl)methyl]-2-[(3-methylphenyl)methylsulfanyl]imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 22576484 |
| Molecular Formula | C19H19ClN2OS |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | [3-[(4-chlorophenyl)methyl]-2-[(3-methylphenyl)methylsulfanyl]imidazol-4-yl]methanol |
| SMILES | Cc1cccc(CSc2ncc(CO)n2Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H19ClN2OS/c1-14-3-2-4-16(9-14)13-24-19-21-10-18(12-23)22(19)11-15-5-7-17(20)8-6-15/h2-10,23H,11-13H2,1H3 |
| InChIKey | ADAFGKCTLNJRQA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |