About [2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol
[2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol (PubChem CID 18589634) has the molecular formula C20H21FN2OS
and a molecular weight of 356.47 g/mol. Its IUPAC name is [2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol.
Molecular Properties
| Compound Name | [2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol |
| PubChem CID | 18589634 |
| Molecular Formula | C20H21FN2OS |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol |
| SMILES | Cc1ccc(C)c(CSc2ncc(CO)n2Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H21FN2OS/c1-14-3-4-15(2)17(9-14)13-25-20-22-10-19(12-24)23(20)11-16-5-7-18(21)8-6-16/h3-10,24H,11-13H2,1-2H3 |
| InChIKey | BETPYNYTDPFRPY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol?
The IUPAC name of [2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol (CID 18589634) is [2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol.
What is the SMILES notation for [2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol?
The canonical SMILES for [2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol is Cc1ccc(C)c(CSc2ncc(CO)n2Cc2ccc(F)cc2)c1.
What is the InChIKey of [2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol?
The InChIKey is BETPYNYTDPFRPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN2OS/c1-14-3-4-15(2)17(9-14)13-25-20-22-10-19(12-24)23(20)11-16-5-7-18(21)8-6-16/h3-10,24H,11-13H2,1-2H3.
What are the key properties of [2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol?
[2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol has a molecular weight of 356.47 g/mol, XLogP of 4.47, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,5-dimethylphenyl)methylsulfanyl]-3-[(4-fluorophenyl)methyl]imidazol-4-yl]methanol is sourced from PubChem (CID 18589634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).