C17H16FN3OS — CID 42797026
[2-[(4-fluorophenyl)methylsulfanyl]-3-(pyridin-4-ylmethyl)imidazol-4-yl]methanol (PubChem CID 42797026) has the molecular formula C17H16FN3OS and a molecular weight of 329.40 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylsulfanyl]-3-(pyridin-4-ylmethyl)imidazol-4-yl]methanol.
| Compound Name | [2-[(4-fluorophenyl)methylsulfanyl]-3-(pyridin-4-ylmethyl)imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 42797026 |
| Molecular Formula | C17H16FN3OS |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | [2-[(4-fluorophenyl)methylsulfanyl]-3-(pyridin-4-ylmethyl)imidazol-4-yl]methanol |
| SMILES | OCc1cnc(SCc2ccc(F)cc2)n1Cc1ccncc1 |
| InChI | InChI=1S/C17H16FN3OS/c18-15-3-1-14(2-4-15)12-23-17-20-9-16(11-22)21(17)10-13-5-7-19-8-6-13/h1-9,22H,10-12H2 |
| InChIKey | JTZBJOFTCQWHJZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |