C18H22BrN3O5S — CID 22578905
5-bromo-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylethyl]furan-2-carboxamide (PubChem CID 22578905) has the molecular formula C18H22BrN3O5S and a molecular weight of 472.36 g/mol. Its IUPAC name is 5-bromo-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 22578905 |
| Molecular Formula | C18H22BrN3O5S |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 5-bromo-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]sulfonylethyl]furan-2-carboxamide |
| SMILES | COc1ccccc1N1CCN(S(=O)(=O)CCNC(=O)c2ccc(Br)o2)CC1 |
| InChI | InChI=1S/C18H22BrN3O5S/c1-26-15-5-3-2-4-14(15)21-9-11-22(12-10-21)28(24,25)13-8-20-18(23)16-6-7-17(19)27-16/h2-7H,8-13H2,1H3,(H,20,23) |
| InChIKey | GTWKYLXVGSLPEP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |