C23H33N5O4S — CID 22579368
3-(benzenesulfonylmethyl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 22579368) has the molecular formula C23H33N5O4S and a molecular weight of 475.62 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 22579368 |
| Molecular Formula | C23H33N5O4S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCCN1CCC(N2CCCCC2)CC1)c1nc(CS(=O)(=O)c2ccccc2)no1 |
| InChI | InChI=1S/C23H33N5O4S/c29-22(23-25-21(26-32-23)18-33(30,31)20-8-3-1-4-9-20)24-12-7-13-27-16-10-19(11-17-27)28-14-5-2-6-15-28/h1,3-4,8-9,19H,2,5-7,10-18H2,(H,24,29) |
| InChIKey | RVYAADHUTMSSAD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|