C16H16ClN5O4S — CID 5300724
3-[(4-chlorophenyl)sulfonylmethyl]-N-(3-imidazol-1-ylpropyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 5300724) has the molecular formula C16H16ClN5O4S and a molecular weight of 409.86 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylmethyl]-N-(3-imidazol-1-ylpropyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-chlorophenyl)sulfonylmethyl]-N-(3-imidazol-1-ylpropyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 5300724 |
| Molecular Formula | C16H16ClN5O4S |
| Molecular Weight | 409.86 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylmethyl]-N-(3-imidazol-1-ylpropyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1nc(CS(=O)(=O)c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C16H16ClN5O4S/c17-12-2-4-13(5-3-12)27(24,25)10-14-20-16(26-21-14)15(23)19-6-1-8-22-9-7-18-11-22/h2-5,7,9,11H,1,6,8,10H2,(H,19,23) |
| InChIKey | JVOZLGNNXIQZAI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.86 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|