C21H23N7O2 — CID 39035223
3-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-N-(3-imidazol-1-ylpropyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 39035223) has the molecular formula C21H23N7O2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 3-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-N-(3-imidazol-1-ylpropyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-N-(3-imidazol-1-ylpropyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 39035223 |
| Molecular Formula | C21H23N7O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 3-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-N-(3-imidazol-1-ylpropyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1cc(C)n(Cc2ccc(-c3noc(C(=O)NCCCn4ccnc4)n3)cc2)n1 |
| InChI | InChI=1S/C21H23N7O2/c1-15-12-16(2)28(25-15)13-17-4-6-18(7-5-17)19-24-21(30-26-19)20(29)23-8-3-10-27-11-9-22-14-27/h4-7,9,11-12,14H,3,8,10,13H2,1-2H3,(H,23,29) |
| InChIKey | MZBDWBQFMAZQSI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 103.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|