C22H22ClN3O3 — CID 22580413
8-chloro-2-[[4-(3-methoxybenzoyl)piperazin-1-yl]methyl]-1H-quinolin-4-one (PubChem CID 22580413) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is 8-chloro-2-[[4-(3-methoxybenzoyl)piperazin-1-yl]methyl]-1H-quinolin-4-one.
| Compound Name | 8-chloro-2-[[4-(3-methoxybenzoyl)piperazin-1-yl]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 22580413 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 8-chloro-2-[[4-(3-methoxybenzoyl)piperazin-1-yl]methyl]-1H-quinolin-4-one |
| SMILES | COc1cccc(C(=O)N2CCN(Cc3cc(=O)c4cccc(Cl)c4[nH]3)CC2)c1 |
| InChI | InChI=1S/C22H22ClN3O3/c1-29-17-5-2-4-15(12-17)22(28)26-10-8-25(9-11-26)14-16-13-20(27)18-6-3-7-19(23)21(18)24-16/h2-7,12-13H,8-11,14H2,1H3,(H,24,27) |
| InChIKey | UDYIEFPLGLAUFW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |