C20H16ClN3O2 — CID 22582393
7-(3-chloro-4-methoxyanilino)-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 22582393) has the molecular formula C20H16ClN3O2 and a molecular weight of 365.82 g/mol. Its IUPAC name is 7-(3-chloro-4-methoxyanilino)-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 7-(3-chloro-4-methoxyanilino)-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 22582393 |
| Molecular Formula | C20H16ClN3O2 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 7-(3-chloro-4-methoxyanilino)-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | COc1ccc(NC2c3ncccc3C(=O)N2c2ccccc2)cc1Cl |
| InChI | InChI=1S/C20H16ClN3O2/c1-26-17-10-9-13(12-16(17)21)23-19-18-15(8-5-11-22-18)20(25)24(19)14-6-3-2-4-7-14/h2-12,19,23H,1H3 |
| InChIKey | BMEVCFRRBAHPDJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|