C21H19N3O3 — CID 92714585
(7R)-7-(2,4-dimethoxyanilino)-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 92714585) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is (7R)-7-(2,4-dimethoxyanilino)-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (7R)-7-(2,4-dimethoxyanilino)-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 92714585 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (7R)-7-(2,4-dimethoxyanilino)-6-phenyl-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | COc1ccc(N[C@H]2c3ncccc3C(=O)N2c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C21H19N3O3/c1-26-15-10-11-17(18(13-15)27-2)23-20-19-16(9-6-12-22-19)21(25)24(20)14-7-4-3-5-8-14/h3-13,20,23H,1-2H3/t20-/m1/s1 |
| InChIKey | HISSCXAOVZZNRT-HXUWFJFHSA-N |
| XLogP | 3.87 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|