C22H20ClN3O4 — CID 22582111
7-(2-chloro-4,6-dimethoxyanilino)-6-(3-methoxyphenyl)-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 22582111) has the molecular formula C22H20ClN3O4 and a molecular weight of 425.87 g/mol. Its IUPAC name is 7-(2-chloro-4,6-dimethoxyanilino)-6-(3-methoxyphenyl)-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 7-(2-chloro-4,6-dimethoxyanilino)-6-(3-methoxyphenyl)-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 22582111 |
| Molecular Formula | C22H20ClN3O4 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 7-(2-chloro-4,6-dimethoxyanilino)-6-(3-methoxyphenyl)-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | COc1cccc(N2C(=O)c3cccnc3C2Nc2c(Cl)cc(OC)cc2OC)c1 |
| InChI | InChI=1S/C22H20ClN3O4/c1-28-14-7-4-6-13(10-14)26-21(19-16(22(26)27)8-5-9-24-19)25-20-17(23)11-15(29-2)12-18(20)30-3/h4-12,21,25H,1-3H3 |
| InChIKey | OEBDAZCLAXHBIQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|