C20H18ClN3O3S — CID 92666272
(7R)-7-(2-chloro-4,6-dimethoxyanilino)-6-(thiophen-2-ylmethyl)-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 92666272) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is (7R)-7-(2-chloro-4,6-dimethoxyanilino)-6-(thiophen-2-ylmethyl)-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (7R)-7-(2-chloro-4,6-dimethoxyanilino)-6-(thiophen-2-ylmethyl)-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 92666272 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | (7R)-7-(2-chloro-4,6-dimethoxyanilino)-6-(thiophen-2-ylmethyl)-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | COc1cc(Cl)c(N[C@H]2c3ncccc3C(=O)N2Cc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C20H18ClN3O3S/c1-26-12-9-15(21)18(16(10-12)27-2)23-19-17-14(6-3-7-22-17)20(25)24(19)11-13-5-4-8-28-13/h3-10,19,23H,11H2,1-2H3/t19-/m1/s1 |
| InChIKey | BGWHNRJRCXEFGP-LJQANCHMSA-N |
| XLogP | 4.58 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|